Orchids Logo
Orchids Logo
Day Schools
Bangalore
Mumbai
Pune
Hyderabad
Chennai
Kolkata
Gurgaon
Indore
Sonipat
Delhi
Chh Sambhaji Nagar
Ahmednagar
Rohtak
Tumkur
Nagpur
Bhopal
Jabalpur
Jodhpur
Jaipur
Hubli-Dharwad
Coimbatore
Dindigul
Boarding Schools
Admission
Study Materials
About Us
More

Types of Organic Reactions: Overview, Mechanisms, Examples and Applications

Organic chemistry is built around the study of carbon compounds and organic reactions are the processes that transform one organic compound into another. These reactions are responsible for producing medicines, plastics, fuels, dyes, perfumes and countless everyday products. 

In this article, types of organic reactions, reaction mechanisms, real-life applications and examples are explained in simplified manner beneficial for exam point of view.

Table of Contents 

Explore Orchids International Schools near you

What are Organic Reactions

Organic reactions are chemical reactions that involve organic compounds, which mainly contain carbon and hydrogen along with elements such as oxygen, nitrogen, sulphur, phosphorus and halogens.

During an organic reaction, existing chemical bonds break and new bonds are formed, producing one or more new organic compounds. These reactions occur naturally in living organisms and are also widely used in laboratories and industries to manufacture useful products.

For example,

CH2=CH2+H2CH3CH3CH_2=CH_2 + H_2 \rightarrow CH_3-CH_3

In this reaction, ethene combines with hydrogen to form ethane.

Characteristics of Organic Reactions

Organic reactions have several unique features that distinguish them from inorganic reactions.

  • They mainly involve carbon-containing compounds.
  • Chemical bonds break and new bonds are formed during the reaction.
  • Most reactions occur through reaction mechanisms involving intermediates.
  • Catalysts, heat, light, or solvents may be required.
  • They are widely used in pharmaceutical, petrochemical and polymer industries.
  • Reaction rates depend on temperature, catalysts and molecular structure.

Organic Reaction Mechanism

A reaction mechanism explains how an organic reaction occurs step by step.

It describes:

  • Which bonds break
  • Which new bonds form
  • Formation of intermediates
  • Electron movement during the reaction

Types of Organic Reactions

Organic reactions are classified according to how molecules change during the reaction.

1. Substitution Reactions

In a substitution reaction, one atom or functional group in a molecule is replaced by another atom or group without changing the carbon skeleton.

Nucleophilic Substitution (SN1 and SN2)

A nucleophile donates electrons and replaces a leaving group attached to carbon.

SN1 Reaction

SN1 is a two-step reaction involving the formation of a carbocation intermediate. The reaction rate depends only on the concentration of the substrate.

Example:

(CH3)3CCl+H2O(CH3)3COH+HCl(CH_3)_3CCl + H_2O \rightarrow (CH_3)_3COH + HCl

SN2 Reaction

SN2 occurs in a single step, where the nucleophile attacks the carbon atom while the leaving group departs simultaneously.

The reaction rate depends on both the substrate and nucleophile.

Example:

CH3Br+OHCH3OH+BrCH_3Br + OH^- \rightarrow CH_3OH + Br^-

Electrophilic Substitution

Electrophilic substitution reaction mainly occurs in aromatic compounds such as benzene.

An electrophile replaces one hydrogen atom on the benzene ring.

Example:

C6H6+HNO3H2SO4C6H5NO2+H2OC_6H_6 + HNO_3 \xrightarrow{H_2SO_4} C_6H_5NO_2 + H_2O

This reaction is known as nitration of benzene.

Know more: Benzene 

2. Addition Reactions

Additional reactions occur when atoms or groups are added across a double or triple bond, converting an unsaturated compound into a saturated one.

Electrophilic Addition

An electrophile attacks the electron-rich multiple bond.

Example: Hydrogenation of Ethene

CH2=CH2+H2PtCH3CH3CH_2=CH_2 + H_2 \xrightarrow{Pt} CH_3-CH_3

This reaction is widely used in the hydrogenation of vegetable oils.

Nucleophilic Addition

A nucleophile attacks the positively charged carbon atom of aldehydes or ketones.

Example:

CH3CHO+H2OCH3CH(OH)2CH_3CHO + H_2O \rightarrow CH_3CH(OH)_2

3. Elimination Reactions

Elimination reactions remove atoms or groups from a molecule, resulting in the formation of double or triple bonds.

These reactions are the opposite of addition reactions.

E1 Elimination

E1 is a two-step reaction involving carbocation formation followed by proton removal.

It generally occurs in tertiary alkyl halides.

E2 Elimination

E2 occurs in a single step where the base removes a hydrogen atom while the leaving group departs simultaneously.

These reactions commonly produce alkenes.

4. Rearrangement Reactions

In rearrangement reactions, atoms or groups migrate within the same molecule to form a more stable structural isomer.

One of the best-known examples is the Beckmann Rearrangement.

Example:

R2C=NOHRCONHRR_2C=NOH \rightarrow RCONHR

This reaction converts an oxime into an amide and is widely used in the chemical industry.

5. Oxidation and Reduction Reactions

These reactions involve changes in the oxidation state of carbon atoms.

Oxidation

Oxidation usually increases the oxygen content or removes hydrogen from a molecule.

Primary alcohols first form aldehydes and then carboxylic acids.

Example:

 CH3CH2OHCH3CHOCH3COOHCH_3CH_2OH \rightarrow CH_3CHO \rightarrow CH_3COOH

 

Reduction

Reduction decreases the oxidation state by adding hydrogen or removing oxygen.

Example:

CH3CH3COCH3NaBH4CH3CH(OH)CH3CH3CH_3COCH_3 \xrightarrow{NaBH_4} CH_3CH(OH)CH_3

Here, acetone is reduced to isopropyl alcohol.

6. Condensation Reactions

Condensation reactions involve the combination of two molecules with the elimination of a small molecule such as water, alcohol, or ammonia.

Aldol Condensation

In aldol condensation, two aldehyde or ketone molecules react in the presence of a base to form a β-hydroxy aldehyde or ketone.

Example:

 [2CH3CHODil. NaOHCH3CH(OH)CH2CHO][ 2\mathrm{CH_3CHO} \xrightarrow{\text{Dil. NaOH}} \mathrm{CH_3CH(OH)CH_2CHO} ]

 

This reaction is widely used in the synthesis of complex organic compounds.

Applications of Organic Reactions

Organic reactions are essential in both nature and modern industries.

Some important applications include:

  • Manufacturing medicines and pharmaceutical products.
  • Production of plastics, polymers and synthetic fibres.
  • Preparation of dyes, paints, perfumes and detergents.
  • Processing petroleum and fuels.
  • Manufacturing pesticides and fertilizers.
  • Food preservation and flavour production.
  • Research in biochemistry and environmental science.

Without organic reactions, the production of many everyday products would not be possible.

We learned that types of Organic reactions are the foundation of organic chemistry and explain how carbon compounds transform into new substances. These reactions are widely applied in medicine, agriculture, manufacturing and scientific research.  

Frequently Asked Questions about Organic Reactions

1. What are organic reactions?

Types of Organic reactions are chemical reactions that involve carbon-containing compounds, where old bonds break and new bonds are formed to create different substances. 

2. What is the difference between E1 and E2 reactions?

E1 is a two-step elimination reaction that forms a carbocation intermediate, whereas E2 occurs in a single step with simultaneous bond breaking and bond formation. 

3. What is a nucleophile?

A nucleophile is an electron-rich atom or molecule that donates a pair of electrons to form a new chemical bond. It plays a key role in many types of organic reactions in Chemistry, especially substitution and addition reactions.

4. What is the role of a catalyst in organic reactions?

A catalyst speeds up an organic reaction without being consumed during the process by lowering the activation energy. Catalysts are widely used in different types of Organic reactions to improve reaction efficiency and product yield.

Science isn't just a subject, it's the way of seeing the world. Curious how Orchids The International School teaches it that way? Talk to our admissions team.

ShareFacebookXLinkedInEmailTelegramPinterestWhatsApp

Admissions Open for 2026-27

Quick Poll

What type of concept pages would you prefer?

We are also listed in